ChemNet > CAS > 306934-95-2 5-fenyl-2-thienylboorzuur
306934-95-2 5-fenyl-2-thienylboorzuur
| Naam product |
5-fenyl-2-thienylboorzuur |
| Synoniemen |
;(5-fenyl-2-thienyl)boorzuur; boorzuur, B-(5-fenyl-2-thienyl)-; (5-fenylthiofeen-2-yl)boorzuur; 2-fenythiofeen-5-ylboronzuur |
| Engelse naam |
5-phenyl-2-thienylboronic acid; (5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
| MF |
C10H9BO2S |
| Molecuulgewicht |
204.0533 |
| InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
| CAS-nummer |
306934-95-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.29g/cm3 |
| Smeltpunt |
146℃ |
| Kookpunt |
412.9°C at 760 mmHg |
| Brekingsindex |
1.632 |
| Vlampunt |
203.5°C |
| Dampdruk |
1.47E-07mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|